C18H26N2O3 — CID 71994599
N-(1-methyl-6-oxopiperidin-3-yl)-3-(4-propoxyphenyl)propanamide (PubChem CID 71994599) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-(1-methyl-6-oxopiperidin-3-yl)-3-(4-propoxyphenyl)propanamide.
| Compound Name | N-(1-methyl-6-oxopiperidin-3-yl)-3-(4-propoxyphenyl)propanamide |
|---|---|
| PubChem CID | 71994599 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | N-(1-methyl-6-oxopiperidin-3-yl)-3-(4-propoxyphenyl)propanamide |
| SMILES | CCCOc1ccc(CCC(=O)NC2CCC(=O)N(C)C2)cc1 |
| InChI | InChI=1S/C18H26N2O3/c1-3-12-23-16-8-4-14(5-9-16)6-10-17(21)19-15-7-11-18(22)20(2)13-15/h4-5,8-9,15H,3,6-7,10-13H2,1-2H3,(H,19,21) |
| InChIKey | KIQAJVHOGBAKCL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |