About 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide
2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide (PubChem CID 71994826) has the molecular formula C15H23N3O2S
and a molecular weight of 309.44 g/mol. Its IUPAC name is 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide.
Molecular Properties
| Compound Name | 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide |
| PubChem CID | 71994826 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)C=Cc1cnc(C(C)(C)C)s1)C(N)=O |
| InChI | InChI=1S/C15H23N3O2S/c1-9(2)12(13(16)20)18-11(19)7-6-10-8-17-14(21-10)15(3,4)5/h6-9,12H,1-5H3,(H2,16,20)(H,18,19) |
| InChIKey | NXEAHCROTOFHFO-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide?
The IUPAC name of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide (CID 71994826) is 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide.
What is the SMILES notation for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide?
The canonical SMILES for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide is CC(C)C(NC(=O)C=Cc1cnc(C(C)(C)C)s1)C(N)=O.
What is the InChIKey of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide?
The InChIKey is NXEAHCROTOFHFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O2S/c1-9(2)12(13(16)20)18-11(19)7-6-10-8-17-14(21-10)15(3,4)5/h6-9,12H,1-5H3,(H2,16,20)(H,18,19).
What are the key properties of 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide?
2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide has a molecular weight of 309.44 g/mol, XLogP of 2.08, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(2-tert-butyl-1,3-thiazol-5-yl)prop-2-enoylamino]-3-methylbutanamide is sourced from PubChem (CID 71994826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).