C16H23NO3S — CID 71994883
1-(1-oxo-1,4-thiazinan-4-yl)-3-(4-propoxyphenyl)propan-1-one (PubChem CID 71994883) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-(1-oxo-1,4-thiazinan-4-yl)-3-(4-propoxyphenyl)propan-1-one.
| Compound Name | 1-(1-oxo-1,4-thiazinan-4-yl)-3-(4-propoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 71994883 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 1-(1-oxo-1,4-thiazinan-4-yl)-3-(4-propoxyphenyl)propan-1-one |
| SMILES | CCCOc1ccc(CCC(=O)N2CCS(=O)CC2)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-2-11-20-15-6-3-14(4-7-15)5-8-16(18)17-9-12-21(19)13-10-17/h3-4,6-7H,2,5,8-13H2,1H3 |
| InChIKey | YSHIXFWHWOCYAS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |