About (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone
(4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone (PubChem CID 71995010) has the molecular formula C16H17ClN2O3
and a molecular weight of 320.78 g/mol. Its IUPAC name is (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 71995010 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone |
| SMILES | COCc1cc(C(=O)N2CC(C)(C)c3c(Cl)cccc32)no1 |
| InChI | InChI=1S/C16H17ClN2O3/c1-16(2)9-19(13-6-4-5-11(17)14(13)16)15(20)12-7-10(8-21-3)22-18-12/h4-7H,8-9H2,1-3H3 |
| InChIKey | JGLKQPQSXRQUCX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone (CID 71995010) is (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone is COCc1cc(C(=O)N2CC(C)(C)c3c(Cl)cccc32)no1.
What is the InChIKey of (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is JGLKQPQSXRQUCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O3/c1-16(2)9-19(13-6-4-5-11(17)14(13)16)15(20)12-7-10(8-21-3)22-18-12/h4-7H,8-9H2,1-3H3.
What are the key properties of (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone?
(4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 320.78 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-3,3-dimethyl-2H-indol-1-yl)-[5-(methoxymethyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 71995010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).