About N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide
N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide (PubChem CID 71995052) has the molecular formula C15H16N2OS2
and a molecular weight of 304.44 g/mol. Its IUPAC name is N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide.
Molecular Properties
| Compound Name | N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide |
| PubChem CID | 71995052 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide |
| SMILES | CN(Cc1cscn1)C(=O)C1SCCc2ccccc21 |
| InChI | InChI=1S/C15H16N2OS2/c1-17(8-12-9-19-10-16-12)15(18)14-13-5-3-2-4-11(13)6-7-20-14/h2-5,9-10,14H,6-8H2,1H3 |
| InChIKey | UZVJDESRDCYPRB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide?
The IUPAC name of N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide (CID 71995052) is N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide.
What is the SMILES notation for N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide?
The canonical SMILES for N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide is CN(Cc1cscn1)C(=O)C1SCCc2ccccc21.
What is the InChIKey of N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide?
The InChIKey is UZVJDESRDCYPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2OS2/c1-17(8-12-9-19-10-16-12)15(18)14-13-5-3-2-4-11(13)6-7-20-14/h2-5,9-10,14H,6-8H2,1H3.
What are the key properties of N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide?
N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide has a molecular weight of 304.44 g/mol, XLogP of 3.13, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(1,3-thiazol-4-ylmethyl)-3,4-dihydro-1H-isothiochromene-1-carboxamide is sourced from PubChem (CID 71995052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).