C16H15FN2O4 — CID 71995768
5-[3-(2-fluoro-6-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 71995768) has the molecular formula C16H15FN2O4 and a molecular weight of 318.30 g/mol. Its IUPAC name is 5-[3-(2-fluoro-6-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 5-[3-(2-fluoro-6-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71995768 |
| Molecular Formula | C16H15FN2O4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-[3-(2-fluoro-6-methoxyphenyl)-3-oxoprop-1-enyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1cccc(F)c1C(=O)C=Cc1cn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C16H15FN2O4/c1-18-9-10(15(21)19(2)16(18)22)7-8-12(20)14-11(17)5-4-6-13(14)23-3/h4-9H,1-3H3 |
| InChIKey | VCDVRRBJQQHPCP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 70.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|