C16H24N6O — CID 71995901
N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 71995901) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 71995901 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | N-[2-[[6-(3,5-dimethylpyrazol-1-yl)pyrazin-2-yl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | Cc1cc(C)n(-c2cncc(NCCNC(=O)C(C)(C)C)n2)n1 |
| InChI | InChI=1S/C16H24N6O/c1-11-8-12(2)22(21-11)14-10-17-9-13(20-14)18-6-7-19-15(23)16(3,4)5/h8-10H,6-7H2,1-5H3,(H,18,20)(H,19,23) |
| InChIKey | JIZNECDKMJEJBW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|