C14H18F2N4O2S — CID 71996527
2-[(6,7-difluoroquinazolin-4-yl)amino]-N,N-diethylethanesulfonamide (PubChem CID 71996527) has the molecular formula C14H18F2N4O2S and a molecular weight of 344.39 g/mol. Its IUPAC name is 2-[(6,7-difluoroquinazolin-4-yl)amino]-N,N-diethylethanesulfonamide.
| Compound Name | 2-[(6,7-difluoroquinazolin-4-yl)amino]-N,N-diethylethanesulfonamide |
|---|---|
| PubChem CID | 71996527 |
| Molecular Formula | C14H18F2N4O2S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[(6,7-difluoroquinazolin-4-yl)amino]-N,N-diethylethanesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)CCNc1ncnc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C14H18F2N4O2S/c1-3-20(4-2)23(21,22)6-5-17-14-10-7-11(15)12(16)8-13(10)18-9-19-14/h7-9H,3-6H2,1-2H3,(H,17,18,19) |
| InChIKey | RZVSACDWUCTDRP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |