C20H21ClFNO4 — CID 7199668
[2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate (PubChem CID 7199668) has the molecular formula C20H21ClFNO4 and a molecular weight of 393.84 g/mol. Its IUPAC name is [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate.
| Compound Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 7199668 |
| Molecular Formula | C20H21ClFNO4 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | [2-(3-fluoro-4-methylanilino)-2-oxoethyl] 4-(4-chloro-3-methylphenoxy)butanoate |
| SMILES | Cc1ccc(NC(=O)COC(=O)CCCOc2ccc(Cl)c(C)c2)cc1F |
| InChI | InChI=1S/C20H21ClFNO4/c1-13-5-6-15(11-18(13)22)23-19(24)12-27-20(25)4-3-9-26-16-7-8-17(21)14(2)10-16/h5-8,10-11H,3-4,9,12H2,1-2H3,(H,23,24) |
| InChIKey | PRZHEGCLIOLJEB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|