About N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide
N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide (PubChem CID 71996719) has the molecular formula C14H18F2N4O2S
and a molecular weight of 344.39 g/mol. Its IUPAC name is N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide.
Molecular Properties
| Compound Name | N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide |
| PubChem CID | 71996719 |
| Molecular Formula | C14H18F2N4O2S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide |
| SMILES | CCN(CCCNc1ncnc2cc(F)c(F)cc12)S(C)(=O)=O |
| InChI | InChI=1S/C14H18F2N4O2S/c1-3-20(23(2,21)22)6-4-5-17-14-10-7-11(15)12(16)8-13(10)18-9-19-14/h7-9H,3-6H2,1-2H3,(H,17,18,19) |
| InChIKey | PLOUIGWGCUSWME-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide?
The IUPAC name of N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide (CID 71996719) is N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide.
What is the SMILES notation for N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide?
The canonical SMILES for N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide is CCN(CCCNc1ncnc2cc(F)c(F)cc12)S(C)(=O)=O.
What is the InChIKey of N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide?
The InChIKey is PLOUIGWGCUSWME-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N4O2S/c1-3-20(23(2,21)22)6-4-5-17-14-10-7-11(15)12(16)8-13(10)18-9-19-14/h7-9H,3-6H2,1-2H3,(H,17,18,19).
What are the key properties of N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide?
N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide has a molecular weight of 344.39 g/mol, XLogP of 1.99, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(6,7-difluoroquinazolin-4-yl)amino]propyl]-N-ethylmethanesulfonamide is sourced from PubChem (CID 71996719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).