About 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide
3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide (PubChem CID 71996747) has the molecular formula C16H24N4O2S
and a molecular weight of 336.46 g/mol. Its IUPAC name is 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide |
| PubChem CID | 71996747 |
| Molecular Formula | C16H24N4O2S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide |
| SMILES | CC1CC(C)CN(CCNc2ccc(S(N)(=O)=O)cc2C#N)C1 |
| InChI | InChI=1S/C16H24N4O2S/c1-12-7-13(2)11-20(10-12)6-5-19-16-4-3-15(23(18,21)22)8-14(16)9-17/h3-4,8,12-13,19H,5-7,10-11H2,1-2H3,(H2,18,21,22) |
| InChIKey | ATPHPGDABUVWAZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide?
The IUPAC name of 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide (CID 71996747) is 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide.
What is the SMILES notation for 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide?
The canonical SMILES for 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide is CC1CC(C)CN(CCNc2ccc(S(N)(=O)=O)cc2C#N)C1.
What is the InChIKey of 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide?
The InChIKey is ATPHPGDABUVWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4O2S/c1-12-7-13(2)11-20(10-12)6-5-19-16-4-3-15(23(18,21)22)8-14(16)9-17/h3-4,8,12-13,19H,5-7,10-11H2,1-2H3,(H2,18,21,22).
What are the key properties of 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide?
3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide has a molecular weight of 336.46 g/mol, XLogP of 1.60, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-4-[2-(3,5-dimethylpiperidin-1-yl)ethylamino]benzenesulfonamide is sourced from PubChem (CID 71996747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).