About 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one
4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one (PubChem CID 71996980) has the molecular formula C9H15NO3S2
and a molecular weight of 249.36 g/mol. Its IUPAC name is 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one.
Molecular Properties
| Compound Name | 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one |
| PubChem CID | 71996980 |
| Molecular Formula | C9H15NO3S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(CCCS(C)(=O)=O)c1C |
| InChI | InChI=1S/C9H15NO3S2/c1-7-8(2)14-9(11)10(7)5-4-6-15(3,12)13/h4-6H2,1-3H3 |
| InChIKey | FMKBSOBWZXXQNG-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one?
The IUPAC name of 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one (CID 71996980) is 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one.
What is the SMILES notation for 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one?
The canonical SMILES for 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one is Cc1sc(=O)n(CCCS(C)(=O)=O)c1C.
What is the InChIKey of 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one?
The InChIKey is FMKBSOBWZXXQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO3S2/c1-7-8(2)14-9(11)10(7)5-4-6-15(3,12)13/h4-6H2,1-3H3.
What are the key properties of 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one?
4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one has a molecular weight of 249.36 g/mol, XLogP of 0.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-3-(3-methylsulfonylpropyl)-1,3-thiazol-2-one is sourced from PubChem (CID 71996980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).