About 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine
4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 71997382) has the molecular formula C15H15ClN2O3S
and a molecular weight of 338.82 g/mol. Its IUPAC name is 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 71997382 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | Cc1ccc2c(c1)OCCN2S(=O)(=O)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C15H15ClN2O3S/c1-11-2-4-13-14(8-11)21-7-6-18(13)22(19,20)10-12-3-5-15(16)17-9-12/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | PVAQCRUPTURYDJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine (CID 71997382) is 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine is Cc1ccc2c(c1)OCCN2S(=O)(=O)Cc1ccc(Cl)nc1.
What is the InChIKey of 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is PVAQCRUPTURYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O3S/c1-11-2-4-13-14(8-11)21-7-6-18(13)22(19,20)10-12-3-5-15(16)17-9-12/h2-5,8-9H,6-7,10H2,1H3.
What are the key properties of 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine?
4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 338.82 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-3-pyridinyl)methylsulfonyl]-7-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 71997382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).