C18H25N3O2S — CID 71997450
N-(1-ethyl-3-methylpiperidin-4-yl)-N-methylquinoline-5-sulfonamide (PubChem CID 71997450) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(1-ethyl-3-methylpiperidin-4-yl)-N-methylquinoline-5-sulfonamide.
| Compound Name | N-(1-ethyl-3-methylpiperidin-4-yl)-N-methylquinoline-5-sulfonamide |
|---|---|
| PubChem CID | 71997450 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-(1-ethyl-3-methylpiperidin-4-yl)-N-methylquinoline-5-sulfonamide |
| SMILES | CCN1CCC(N(C)S(=O)(=O)c2cccc3ncccc23)C(C)C1 |
| InChI | InChI=1S/C18H25N3O2S/c1-4-21-12-10-17(14(2)13-21)20(3)24(22,23)18-9-5-8-16-15(18)7-6-11-19-16/h5-9,11,14,17H,4,10,12-13H2,1-3H3 |
| InChIKey | SWBYJJDDYXSHNL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |