About N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide
N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide (PubChem CID 71997464) has the molecular formula C15H27N3O2S2
and a molecular weight of 345.53 g/mol. Its IUPAC name is N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 71997464 |
| Molecular Formula | C15H27N3O2S2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide |
| SMILES | CCc1nc(C)c(C(C)N(C)S(=O)(=O)N2CCCC(C)C2)s1 |
| InChI | InChI=1S/C15H27N3O2S2/c1-6-14-16-12(3)15(21-14)13(4)17(5)22(19,20)18-9-7-8-11(2)10-18/h11,13H,6-10H2,1-5H3 |
| InChIKey | FZZTWTGZKCDTPK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide?
The IUPAC name of N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide (CID 71997464) is N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide is CCc1nc(C)c(C(C)N(C)S(=O)(=O)N2CCCC(C)C2)s1.
What is the InChIKey of N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide?
The InChIKey is FZZTWTGZKCDTPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O2S2/c1-6-14-16-12(3)15(21-14)13(4)17(5)22(19,20)18-9-7-8-11(2)10-18/h11,13H,6-10H2,1-5H3.
What are the key properties of N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide?
N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide has a molecular weight of 345.53 g/mol, XLogP of 2.98, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2-ethyl-4-methyl-1,3-thiazol-5-yl)ethyl]-N,3-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 71997464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).