C12H14F3NO3S2 — CID 71997514
2,3-dimethyl-4-(3,4,5-trifluorophenyl)sulfonyl-1,4-thiazinane 1-oxide (PubChem CID 71997514) has the molecular formula C12H14F3NO3S2 and a molecular weight of 341.38 g/mol. Its IUPAC name is 2,3-dimethyl-4-(3,4,5-trifluorophenyl)sulfonyl-1,4-thiazinane 1-oxide.
| Compound Name | 2,3-dimethyl-4-(3,4,5-trifluorophenyl)sulfonyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 71997514 |
| Molecular Formula | C12H14F3NO3S2 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | 2,3-dimethyl-4-(3,4,5-trifluorophenyl)sulfonyl-1,4-thiazinane 1-oxide |
| SMILES | CC1C(C)S(=O)CCN1S(=O)(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C12H14F3NO3S2/c1-7-8(2)20(17)4-3-16(7)21(18,19)9-5-10(13)12(15)11(14)6-9/h5-8H,3-4H2,1-2H3 |
| InChIKey | YOKFEQFFKOVIFS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|