C13H13F3N2O3S — CID 71997561
3,4,5-trifluoro-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]benzenesulfonamide (PubChem CID 71997561) has the molecular formula C13H13F3N2O3S and a molecular weight of 334.32 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 3,4,5-trifluoro-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 71997561 |
| Molecular Formula | C13H13F3N2O3S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 3,4,5-trifluoro-N-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]benzenesulfonamide |
| SMILES | CC(C)c1cc(CNS(=O)(=O)c2cc(F)c(F)c(F)c2)on1 |
| InChI | InChI=1S/C13H13F3N2O3S/c1-7(2)12-3-8(21-18-12)6-17-22(19,20)9-4-10(14)13(16)11(15)5-9/h3-5,7,17H,6H2,1-2H3 |
| InChIKey | UVFDEAKFDCCNBL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|