About 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide
2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide (PubChem CID 71997588) has the molecular formula C17H29N3O2S
and a molecular weight of 339.50 g/mol. Its IUPAC name is 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide |
| PubChem CID | 71997588 |
| Molecular Formula | C17H29N3O2S |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCN(C)C(CNS(=O)(=O)c2ccccc2C(C)(C)C)C1 |
| InChI | InChI=1S/C17H29N3O2S/c1-17(2,3)15-8-6-7-9-16(15)23(21,22)18-12-14-13-19(4)10-11-20(14)5/h6-9,14,18H,10-13H2,1-5H3 |
| InChIKey | YWMQOOIFXUKRPW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide?
The IUPAC name of 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide (CID 71997588) is 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide.
What is the SMILES notation for 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide?
The canonical SMILES for 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide is CN1CCN(C)C(CNS(=O)(=O)c2ccccc2C(C)(C)C)C1.
What is the InChIKey of 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide?
The InChIKey is YWMQOOIFXUKRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O2S/c1-17(2,3)15-8-6-7-9-16(15)23(21,22)18-12-14-13-19(4)10-11-20(14)5/h6-9,14,18H,10-13H2,1-5H3.
What are the key properties of 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide?
2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide has a molecular weight of 339.50 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 71997588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).