C8H9F5N2O3S — CID 71997615
N-methyl-1-(1,2-oxazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide (PubChem CID 71997615) has the molecular formula C8H9F5N2O3S and a molecular weight of 308.23 g/mol. Its IUPAC name is N-methyl-1-(1,2-oxazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide.
| Compound Name | N-methyl-1-(1,2-oxazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide |
|---|---|
| PubChem CID | 71997615 |
| Molecular Formula | C8H9F5N2O3S |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | N-methyl-1-(1,2-oxazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)methanesulfonamide |
| SMILES | CN(CC(F)(F)C(F)(F)F)S(=O)(=O)Cc1ccon1 |
| InChI | InChI=1S/C8H9F5N2O3S/c1-15(5-7(9,10)8(11,12)13)19(16,17)4-6-2-3-18-14-6/h2-3H,4-5H2,1H3 |
| InChIKey | YHLFZJPGOLHKDU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|