C16H21F3N2O3 — CID 71997949
(3-hydroxypiperidin-1-yl)-[3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]methanone (PubChem CID 71997949) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is (3-hydroxypiperidin-1-yl)-[3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]methanone.
| Compound Name | (3-hydroxypiperidin-1-yl)-[3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]methanone |
|---|---|
| PubChem CID | 71997949 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (3-hydroxypiperidin-1-yl)-[3-[2-(2,2,2-trifluoroethoxy)ethylamino]phenyl]methanone |
| SMILES | O=C(c1cccc(NCCOCC(F)(F)F)c1)N1CCCC(O)C1 |
| InChI | InChI=1S/C16H21F3N2O3/c17-16(18,19)11-24-8-6-20-13-4-1-3-12(9-13)15(23)21-7-2-5-14(22)10-21/h1,3-4,9,14,20,22H,2,5-8,10-11H2 |
| InChIKey | IIGDDHGFAUUOJK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|