About N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide
N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide (PubChem CID 71998914) has the molecular formula C16H18F3NO3
and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide.
Molecular Properties
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide |
| PubChem CID | 71998914 |
| Molecular Formula | C16H18F3NO3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide |
| SMILES | O=C(NC1(c2cccc(C(F)(F)F)c2)CCC1)C1COCCO1 |
| InChI | InChI=1S/C16H18F3NO3/c17-16(18,19)12-4-1-3-11(9-12)15(5-2-6-15)20-14(21)13-10-22-7-8-23-13/h1,3-4,9,13H,2,5-8,10H2,(H,20,21) |
| InChIKey | TYBZXXKLQXWMLL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide?
The IUPAC name of N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide (CID 71998914) is N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide.
What is the SMILES notation for N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide?
The canonical SMILES for N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide is O=C(NC1(c2cccc(C(F)(F)F)c2)CCC1)C1COCCO1.
What is the InChIKey of N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide?
The InChIKey is TYBZXXKLQXWMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F3NO3/c17-16(18,19)12-4-1-3-11(9-12)15(5-2-6-15)20-14(21)13-10-22-7-8-23-13/h1,3-4,9,13H,2,5-8,10H2,(H,20,21).
What are the key properties of N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide?
N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide has a molecular weight of 329.32 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[3-(trifluoromethyl)phenyl]cyclobutyl]-1,4-dioxane-2-carboxamide is sourced from PubChem (CID 71998914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).