C12H13F2N3O2S — CID 71999548
2-[2-[[5-(3,5-difluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol (PubChem CID 71999548) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-[2-[[5-(3,5-difluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol.
| Compound Name | 2-[2-[[5-(3,5-difluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol |
|---|---|
| PubChem CID | 71999548 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[2-[[5-(3,5-difluorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]ethoxy]ethanol |
| SMILES | OCCOCCSc1n[nH]c(-c2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C12H13F2N3O2S/c13-9-5-8(6-10(14)7-9)11-15-12(17-16-11)20-4-3-19-2-1-18/h5-7,18H,1-4H2,(H,15,16,17) |
| InChIKey | OXHDNOAUYRJDAO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|