C11H22NO+ — CID 7200592
(2S,4S,5R)-1,2,5-trimethyl-4-prop-2-enylpiperidin-1-ium-4-ol (PubChem CID 7200592) has the molecular formula C11H22NO+ and a molecular weight of 184.30 g/mol. Its IUPAC name is (2S,4S,5R)-1,2,5-trimethyl-4-prop-2-enylpiperidin-1-ium-4-ol.
| Compound Name | (2S,4S,5R)-1,2,5-trimethyl-4-prop-2-enylpiperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 7200592 |
| Molecular Formula | C11H22NO+ |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | (2S,4S,5R)-1,2,5-trimethyl-4-prop-2-enylpiperidin-1-ium-4-ol |
| SMILES | C=CC[C@]1(O)C[C@H](C)[NH+](C)C[C@H]1C |
| InChI | InChI=1S/C11H21NO/c1-5-6-11(13)7-10(3)12(4)8-9(11)2/h5,9-10,13H,1,6-8H2,2-4H3/p+1/t9-,10+,11+/m1/s1 |
| InChIKey | HAYJMKCUHUHZDC-VWYCJHECSA-O |
| XLogP | 0.24 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|