C20H17N4+ — CID 720072
N,1,4-triphenyl-1,2,4-triazol-4-ium-3-amine (PubChem CID 720072) has the molecular formula C20H17N4+ and a molecular weight of 313.38 g/mol. Its IUPAC name is N,1,4-triphenyl-1,2,4-triazol-4-ium-3-amine.
| Compound Name | N,1,4-triphenyl-1,2,4-triazol-4-ium-3-amine |
|---|---|
| PubChem CID | 720072 |
| Molecular Formula | C20H17N4+ |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | N,1,4-triphenyl-1,2,4-triazol-4-ium-3-amine |
| SMILES | c1ccc(Nc2nn(-c3ccccc3)c[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C20H17N4/c1-4-10-17(11-5-1)21-20-22-24(19-14-8-3-9-15-19)16-23(20)18-12-6-2-7-13-18/h1-16H,(H,21,22)/q+1 |
| InChIKey | VCENNVLGXGBYPH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|