C20H19N3O2 — CID 720121
[4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-piperidin-1-ylmethanone (PubChem CID 720121) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is [4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 720121 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [4-(5-phenyl-1,3,4-oxadiazol-2-yl)phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(-c2nnc(-c3ccccc3)o2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C20H19N3O2/c24-20(23-13-5-2-6-14-23)17-11-9-16(10-12-17)19-22-21-18(25-19)15-7-3-1-4-8-15/h1,3-4,7-12H,2,5-6,13-14H2 |
| InChIKey | ABCFVODVDZZUQU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |