C11H22NO+ — CID 7201222
(2R,5R)-5-tert-butyl-1,2-dimethylpiperidin-1-ium-3-one (PubChem CID 7201222) has the molecular formula C11H22NO+ and a molecular weight of 184.30 g/mol. Its IUPAC name is (2R,5R)-5-tert-butyl-1,2-dimethylpiperidin-1-ium-3-one.
| Compound Name | (2R,5R)-5-tert-butyl-1,2-dimethylpiperidin-1-ium-3-one |
|---|---|
| PubChem CID | 7201222 |
| Molecular Formula | C11H22NO+ |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | (2R,5R)-5-tert-butyl-1,2-dimethylpiperidin-1-ium-3-one |
| SMILES | C[C@@H]1C(=O)C[C@H](C(C)(C)C)C[NH+]1C |
| InChI | InChI=1S/C11H21NO/c1-8-10(13)6-9(7-12(8)5)11(2,3)4/h8-9H,6-7H2,1-5H3/p+1/t8-,9+/m1/s1 |
| InChIKey | XDPTWFUYZSATFF-BDAKNGLRSA-O |
| XLogP | 0.52 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |