C10H20N2O3 — CID 7201375
tert-butyl N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]carbamate (PubChem CID 7201375) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 7201375 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | tert-butyl N-[(2S)-1-(ethylamino)-1-oxopropan-2-yl]carbamate |
| SMILES | CCNC(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H20N2O3/c1-6-11-8(13)7(2)12-9(14)15-10(3,4)5/h7H,6H2,1-5H3,(H,11,13)(H,12,14)/t7-/m0/s1 |
| InChIKey | IUYXQFLOYFCQKL-ZETCQYMHSA-N |
| XLogP | 1.04 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |