C20H18N4O2 — CID 720149
1-N,3-N-bis(6-methyl-2-pyridinyl)benzene-1,3-dicarboxamide (PubChem CID 720149) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is 1-N,3-N-bis(6-methyl-2-pyridinyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(6-methyl-2-pyridinyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 720149 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 1-N,3-N-bis(6-methyl-2-pyridinyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(C(=O)Nc3cccc(C)n3)c2)n1 |
| InChI | InChI=1S/C20H18N4O2/c1-13-6-3-10-17(21-13)23-19(25)15-8-5-9-16(12-15)20(26)24-18-11-4-7-14(2)22-18/h3-12H,1-2H3,(H,21,23,25)(H,22,24,26) |
| InChIKey | NATVKKXERQXPEP-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |