About 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium
1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium (PubChem CID 7201585) has the molecular formula C20H28N2O4S2+2
and a molecular weight of 424.59 g/mol. Its IUPAC name is 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium.
Molecular Properties
| Compound Name | 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium |
| PubChem CID | 7201585 |
| Molecular Formula | C20H28N2O4S2+2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium |
| SMILES | O=S(=O)(CC[NH+]1CC[NH+](CCS(=O)(=O)c2ccccc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O4S2/c23-27(24,19-7-3-1-4-8-19)17-15-21-11-13-22(14-12-21)16-18-28(25,26)20-9-5-2-6-10-20/h1-10H,11-18H2/p+2 |
| InChIKey | WGFMMJBLXXZILY-UHFFFAOYSA-P |
| XLogP | -1.28 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium?
The IUPAC name of 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium (CID 7201585) is 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium.
What is the SMILES notation for 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium?
The canonical SMILES for 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium is O=S(=O)(CC[NH+]1CC[NH+](CCS(=O)(=O)c2ccccc2)CC1)c1ccccc1.
What is the InChIKey of 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium?
The InChIKey is WGFMMJBLXXZILY-UHFFFAOYSA-P. The full InChI is InChI=1S/C20H26N2O4S2/c23-27(24,19-7-3-1-4-8-19)17-15-21-11-13-22(14-12-21)16-18-28(25,26)20-9-5-2-6-10-20/h1-10H,11-18H2/p+2.
What are the key properties of 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium?
1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium has a molecular weight of 424.59 g/mol, XLogP of -1.28, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[2-(benzenesulfonyl)ethyl]piperazine-1,4-diium is sourced from PubChem (CID 7201585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).