C12H9N5O3S2 — CID 7202444
3-methyl-7-[(4-nitrophenyl)methylsulfanyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one (PubChem CID 7202444) has the molecular formula C12H9N5O3S2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 3-methyl-7-[(4-nitrophenyl)methylsulfanyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one.
| Compound Name | 3-methyl-7-[(4-nitrophenyl)methylsulfanyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 7202444 |
| Molecular Formula | C12H9N5O3S2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 3-methyl-7-[(4-nitrophenyl)methylsulfanyl]-[1,3,4]thiadiazolo[2,3-c][1,2,4]triazin-4-one |
| SMILES | Cc1nnc2sc(SCc3ccc([N+](=O)[O-])cc3)nn2c1=O |
| InChI | InChI=1S/C12H9N5O3S2/c1-7-10(18)16-11(14-13-7)22-12(15-16)21-6-8-2-4-9(5-3-8)17(19)20/h2-5H,6H2,1H3 |
| InChIKey | FJDDITKBCDBMPS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|