C17H22NO2+ — CID 7203543
4-[[(1R)-6-methoxy-1,2,3,4,5,8-hexahydroisoquinolin-2-ium-1-yl]methyl]phenol (PubChem CID 7203543) has the molecular formula C17H22NO2+ and a molecular weight of 272.37 g/mol. Its IUPAC name is 4-[[(1R)-6-methoxy-1,2,3,4,5,8-hexahydroisoquinolin-2-ium-1-yl]methyl]phenol.
| Compound Name | 4-[[(1R)-6-methoxy-1,2,3,4,5,8-hexahydroisoquinolin-2-ium-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 7203543 |
| Molecular Formula | C17H22NO2+ |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-[[(1R)-6-methoxy-1,2,3,4,5,8-hexahydroisoquinolin-2-ium-1-yl]methyl]phenol |
| SMILES | COC1=CCC2=C(CC[NH2+][C@@H]2Cc2ccc(O)cc2)C1 |
| InChI | InChI=1S/C17H21NO2/c1-20-15-6-7-16-13(11-15)8-9-18-17(16)10-12-2-4-14(19)5-3-12/h2-6,17-19H,7-11H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | DYFRJIOGPUMGML-QGZVFWFLSA-O |
| XLogP | 1.89 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|