C12H10F6N2 — CID 7203615
(1R,2R)-4,5-dimethyl-1,2-bis(trifluoromethyl)cyclohex-4-ene-1,2-dicarbonitrile (PubChem CID 7203615) has the molecular formula C12H10F6N2 and a molecular weight of 296.21 g/mol. Its IUPAC name is (1R,2R)-4,5-dimethyl-1,2-bis(trifluoromethyl)cyclohex-4-ene-1,2-dicarbonitrile.
| Compound Name | (1R,2R)-4,5-dimethyl-1,2-bis(trifluoromethyl)cyclohex-4-ene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 7203615 |
| Molecular Formula | C12H10F6N2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (1R,2R)-4,5-dimethyl-1,2-bis(trifluoromethyl)cyclohex-4-ene-1,2-dicarbonitrile |
| SMILES | CC1=C(C)C[C@@](C#N)(C(F)(F)F)[C@](C#N)(C(F)(F)F)C1 |
| InChI | InChI=1S/C12H10F6N2/c1-7-3-9(5-19,11(13,14)15)10(6-20,4-8(7)2)12(16,17)18/h3-4H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | SFGPPXMQDSSDRM-UWVGGRQHSA-N |
| XLogP | 4.26 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|