C18H18NO5- — CID 7203815
4-[[(1R,3R)-3-benzoyl-2,6-dioxocyclohexyl]methylideneamino]butanoate (PubChem CID 7203815) has the molecular formula C18H18NO5- and a molecular weight of 328.34 g/mol. Its IUPAC name is 4-[[(1R,3R)-3-benzoyl-2,6-dioxocyclohexyl]methylideneamino]butanoate.
| Compound Name | 4-[[(1R,3R)-3-benzoyl-2,6-dioxocyclohexyl]methylideneamino]butanoate |
|---|---|
| PubChem CID | 7203815 |
| Molecular Formula | C18H18NO5- |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-[[(1R,3R)-3-benzoyl-2,6-dioxocyclohexyl]methylideneamino]butanoate |
| SMILES | O=C([O-])CCC/N=C/[C@@H]1C(=O)CC[C@@H](C(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C18H19NO5/c20-15-9-8-13(17(23)12-5-2-1-3-6-12)18(24)14(15)11-19-10-4-7-16(21)22/h1-3,5-6,11,13-14H,4,7-10H2,(H,21,22)/p-1/b19-11+/t13-,14+/m0/s1 |
| InChIKey | HSTZTQGUUYBARN-ZBGMRHGXSA-M |
| XLogP | 0.63 |
| TPSA | 103.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|