C12H16ClFN2O2 — CID 72040704
1-(3-Chloro-4-fluorophenyl)-3-(2-hydroxy-3-methylbutyl)urea (PubChem CID 72040704) has the molecular formula C12H16ClFN2O2 and a molecular weight of 274.72 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-(2-hydroxy-3-methylbutyl)urea.
| Compound Name | 1-(3-Chloro-4-fluorophenyl)-3-(2-hydroxy-3-methylbutyl)urea |
|---|---|
| PubChem CID | 72040704 |
| Molecular Formula | C12H16ClFN2O2 |
| Molecular Weight | 274.72 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-(2-hydroxy-3-methylbutyl)urea |
| SMILES | CC(C)C(CNC(=O)NC1=CC(=C(C=C1)F)Cl)O |
| InChI | InChI=1S/C12H16ClFN2O2/c1-7(2)11(17)6-15-12(18)16-8-3-4-10(14)9(13)5-8/h3-5,7,11,17H,6H2,1-2H3,(H2,15,16,18) |
| InChIKey | BMRPJWNQWWXBOC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | 279 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |