About N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride
N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride (PubChem CID 72046366) has the molecular formula C12H15ClF3N3O2
and a molecular weight of 325.71 g/mol. Its IUPAC name is N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride |
| PubChem CID | 72046366 |
| Molecular Formula | C12H15ClF3N3O2 |
| Molecular Weight | 325.71 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride |
| SMILES | C1CCNC(C1)C(=O)NC2=CC(=CNC2=O)C(F)(F)F.Cl |
| InChI | InChI=1S/C12H14F3N3O2.ClH/c13-12(14,15)7-5-9(10(19)17-6-7)18-11(20)8-3-1-2-4-16-8;/h5-6,8,16H,1-4H2,(H,17,19)(H,18,20);1H |
| InChIKey | RLPAVBYETXSKRB-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 70.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | 483 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride?
The IUPAC name of N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride (CID 72046366) is N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride.
What is the SMILES notation for N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride?
The canonical SMILES for N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride is C1CCNC(C1)C(=O)NC2=CC(=CNC2=O)C(F)(F)F.Cl.
What is the InChIKey of N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride?
The InChIKey is RLPAVBYETXSKRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O2.ClH/c13-12(14,15)7-5-9(10(19)17-6-7)18-11(20)8-3-1-2-4-16-8;/h5-6,8,16H,1-4H2,(H,17,19)(H,18,20);1H.
What are the key properties of N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride?
N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride has a molecular weight of 325.71 g/mol, XLogP of not available, 2 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]piperidine-2-carboxamide;hydrochloride is sourced from PubChem (CID 72046366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).