About 4-bromo-1,2-dimethylimidazole
4-bromo-1,2-dimethylimidazole (PubChem CID 7204875) has the molecular formula C5H7BrN2
and a molecular weight of 175.03 g/mol. Its IUPAC name is 4-bromo-1,2-dimethylimidazole.
Molecular Properties
| Compound Name | 4-bromo-1,2-dimethylimidazole |
| PubChem CID | 7204875 |
| Molecular Formula | C5H7BrN2 |
| Molecular Weight | 175.03 g/mol |
| Exact Mass | 173.98 |
| IUPAC Name | 4-bromo-1,2-dimethylimidazole |
| SMILES | Cc1nc(Br)cn1C |
| InChI | InChI=1S/C5H7BrN2/c1-4-7-5(6)3-8(4)2/h3H,1-2H3 |
| InChIKey | FZRKTLGQQTWOMJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.03 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1,2-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,2-dimethylimidazole?
The IUPAC name of 4-bromo-1,2-dimethylimidazole (CID 7204875) is 4-bromo-1,2-dimethylimidazole.
What is the SMILES notation for 4-bromo-1,2-dimethylimidazole?
The canonical SMILES for 4-bromo-1,2-dimethylimidazole is Cc1nc(Br)cn1C.
What is the InChIKey of 4-bromo-1,2-dimethylimidazole?
The InChIKey is FZRKTLGQQTWOMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7BrN2/c1-4-7-5(6)3-8(4)2/h3H,1-2H3.
What are the key properties of 4-bromo-1,2-dimethylimidazole?
4-bromo-1,2-dimethylimidazole has a molecular weight of 175.03 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,2-dimethylimidazole is sourced from PubChem (CID 7204875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).