C15H13N3O3 — CID 720524
2-(4-ethoxy-3-nitrophenyl)imidazo[1,2-a]pyridine (PubChem CID 720524) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-(4-ethoxy-3-nitrophenyl)imidazo[1,2-a]pyridine.
| Compound Name | 2-(4-ethoxy-3-nitrophenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 720524 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-(4-ethoxy-3-nitrophenyl)imidazo[1,2-a]pyridine |
| SMILES | CCOc1ccc(-c2cn3ccccc3n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O3/c1-2-21-14-7-6-11(9-13(14)18(19)20)12-10-17-8-4-3-5-15(17)16-12/h3-10H,2H2,1H3 |
| InChIKey | BLEYVVGMXJJTRI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|