C13H16ClN3 — CID 7205295
(2S)-N-benzyl-1-chloro-3-(1H-imidazol-5-yl)propan-2-amine (PubChem CID 7205295) has the molecular formula C13H16ClN3 and a molecular weight of 249.75 g/mol. Its IUPAC name is (2S)-N-benzyl-1-chloro-3-(1H-imidazol-5-yl)propan-2-amine.
| Compound Name | (2S)-N-benzyl-1-chloro-3-(1H-imidazol-5-yl)propan-2-amine |
|---|---|
| PubChem CID | 7205295 |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.75 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-N-benzyl-1-chloro-3-(1H-imidazol-5-yl)propan-2-amine |
| SMILES | ClC[C@H](Cc1cnc[nH]1)NCc1ccccc1 |
| InChI | InChI=1S/C13H16ClN3/c14-7-12(6-13-9-15-10-17-13)16-8-11-4-2-1-3-5-11/h1-5,9-10,12,16H,6-8H2,(H,15,17)/t12-/m0/s1 |
| InChIKey | UJXAKNNVMUDNLF-LBPRGKRZSA-N |
| XLogP | 2.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.75 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|