C17H23N3O — CID 7205574
(4R)-4-(tert-butyliminomethyl)-2-(3,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one (PubChem CID 7205574) has the molecular formula C17H23N3O and a molecular weight of 285.39 g/mol. Its IUPAC name is (4R)-4-(tert-butyliminomethyl)-2-(3,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one.
| Compound Name | (4R)-4-(tert-butyliminomethyl)-2-(3,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
|---|---|
| PubChem CID | 7205574 |
| Molecular Formula | C17H23N3O |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (4R)-4-(tert-butyliminomethyl)-2-(3,4-dimethylphenyl)-5-methyl-4H-pyrazol-3-one |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)[C@@H]1/C=N/C(C)(C)C |
| InChI | InChI=1S/C17H23N3O/c1-11-7-8-14(9-12(11)2)20-16(21)15(13(3)19-20)10-18-17(4,5)6/h7-10,15H,1-6H3/b18-10+/t15-/m1/s1 |
| InChIKey | TYXSXAQBRJBGCT-BFERYNQYSA-N |
| XLogP | 3.51 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|