C21H20N6O2 — CID 7205651
N'-[1-(2,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-methoxybenzohydrazide (PubChem CID 7205651) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N'-[1-(2,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-methoxybenzohydrazide.
| Compound Name | N'-[1-(2,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 7205651 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N'-[1-(2,4-dimethylphenyl)pyrazolo[3,4-d]pyrimidin-4-yl]-4-methoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNc2ncnc3c2cnn3-c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C21H20N6O2/c1-13-4-9-18(14(2)10-13)27-20-17(11-24-27)19(22-12-23-20)25-26-21(28)15-5-7-16(29-3)8-6-15/h4-12H,1-3H3,(H,26,28)(H,22,23,25) |
| InChIKey | WDZVDHUSNGFQCO-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|