C19H15FN2O2S — CID 7206085
1-(4-fluorophenyl)-2-[6-(2-methoxyphenyl)pyridazin-3-yl]sulfanylethanone (PubChem CID 7206085) has the molecular formula C19H15FN2O2S and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[6-(2-methoxyphenyl)pyridazin-3-yl]sulfanylethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[6-(2-methoxyphenyl)pyridazin-3-yl]sulfanylethanone |
|---|---|
| PubChem CID | 7206085 |
| Molecular Formula | C19H15FN2O2S |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[6-(2-methoxyphenyl)pyridazin-3-yl]sulfanylethanone |
| SMILES | COc1ccccc1-c1ccc(SCC(=O)c2ccc(F)cc2)nn1 |
| InChI | InChI=1S/C19H15FN2O2S/c1-24-18-5-3-2-4-15(18)16-10-11-19(22-21-16)25-12-17(23)13-6-8-14(20)9-7-13/h2-11H,12H2,1H3 |
| InChIKey | BBQYQWXJXCRLGG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |