About 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine
4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine (PubChem CID 720656) has the molecular formula C13H13BrN2OS
and a molecular weight of 325.23 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine.
Molecular Properties
| Compound Name | 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine |
| PubChem CID | 720656 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine |
| SMILES | Brc1ccc(-c2csc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C13H13BrN2OS/c14-11-3-1-10(2-4-11)12-9-18-13(15-12)16-5-7-17-8-6-16/h1-4,9H,5-8H2 |
| InChIKey | ZMYGKCYCJZPXRE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine?
The IUPAC name of 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine (CID 720656) is 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine.
What is the SMILES notation for 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine?
The canonical SMILES for 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine is Brc1ccc(-c2csc(N3CCOCC3)n2)cc1.
What is the InChIKey of 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine?
The InChIKey is ZMYGKCYCJZPXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BrN2OS/c14-11-3-1-10(2-4-11)12-9-18-13(15-12)16-5-7-17-8-6-16/h1-4,9H,5-8H2.
What are the key properties of 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine?
4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine has a molecular weight of 325.23 g/mol, XLogP of 3.41, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(4-bromophenyl)-1,3-thiazol-2-yl]morpholine is sourced from PubChem (CID 720656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).