C8H11N5O5 — CID 7206708
trans-(1S,2S)-2-(3,5-dinitro-1,2,4-triazol-1-yl)cyclohexan-1-ol (PubChem CID 7206708) has the molecular formula C8H11N5O5 and a molecular weight of 257.21 g/mol. Its IUPAC name is trans-(1S,2S)-2-(3,5-dinitro-1,2,4-triazol-1-yl)cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-(3,5-dinitro-1,2,4-triazol-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 7206708 |
| Molecular Formula | C8H11N5O5 |
| Molecular Weight | 257.21 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | trans-(1S,2S)-2-(3,5-dinitro-1,2,4-triazol-1-yl)cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1nc([N+](=O)[O-])n([C@H]2CCCC[C@@H]2O)n1 |
| InChI | InChI=1S/C8H11N5O5/c14-6-4-2-1-3-5(6)11-8(13(17)18)9-7(10-11)12(15)16/h5-6,14H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | WUFNKQZQZKJIEX-WDSKDSINSA-N |
| XLogP | 0.57 |
| TPSA | 137.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|