C18H27N3O5S — CID 7207050
N-[[(2R)-3-(2,5-dimethylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-propan-2-yloxamide (PubChem CID 7207050) has the molecular formula C18H27N3O5S and a molecular weight of 397.50 g/mol. Its IUPAC name is N-[[(2R)-3-(2,5-dimethylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-propan-2-yloxamide.
| Compound Name | N-[[(2R)-3-(2,5-dimethylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-propan-2-yloxamide |
|---|---|
| PubChem CID | 7207050 |
| Molecular Formula | C18H27N3O5S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[[(2R)-3-(2,5-dimethylphenyl)sulfonyl-1,3-oxazinan-2-yl]methyl]-N'-propan-2-yloxamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCCO[C@@H]2CNC(=O)C(=O)NC(C)C)c1 |
| InChI | InChI=1S/C18H27N3O5S/c1-12(2)20-18(23)17(22)19-11-16-21(8-5-9-26-16)27(24,25)15-10-13(3)6-7-14(15)4/h6-7,10,12,16H,5,8-9,11H2,1-4H3,(H,19,22)(H,20,23)/t16-/m1/s1 |
| InChIKey | WVZCLCXSTDYFIQ-MRXNPFEDSA-N |
| XLogP | 0.68 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|