C9H15ClN2O2 — CID 720708
(5R,6R)-3-tert-butyl-5-chloro-6-methyl-1,3-diazinane-2,4-dione (PubChem CID 720708) has the molecular formula C9H15ClN2O2 and a molecular weight of 218.68 g/mol. Its IUPAC name is (5R,6R)-3-tert-butyl-5-chloro-6-methyl-1,3-diazinane-2,4-dione.
| Compound Name | (5R,6R)-3-tert-butyl-5-chloro-6-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 720708 |
| Molecular Formula | C9H15ClN2O2 |
| Molecular Weight | 218.68 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | (5R,6R)-3-tert-butyl-5-chloro-6-methyl-1,3-diazinane-2,4-dione |
| SMILES | C[C@H]1NC(=O)N(C(C)(C)C)C(=O)[C@@H]1Cl |
| InChI | InChI=1S/C9H15ClN2O2/c1-5-6(10)7(13)12(8(14)11-5)9(2,3)4/h5-6H,1-4H3,(H,11,14)/t5-,6-/m1/s1 |
| InChIKey | CUHLYCUCQYKUPZ-PHDIDXHHSA-N |
| XLogP | 1.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.68 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|