About Otilonium
Otilonium (PubChem CID 72093) has the molecular formula C29H43N2O4+
and a molecular weight of 483.70 g/mol. Its IUPAC name is diethyl-methyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium.
Molecular Properties
| Compound Name | Otilonium |
| PubChem CID | 72093 |
| Molecular Formula | C29H43N2O4+ |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | diethyl-methyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium |
| SMILES | CCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)OCC[N+](C)(CC)CC |
| InChI | InChI=1S/C29H42N2O4/c1-5-8-9-10-11-14-22-34-27-16-13-12-15-26(27)28(32)30-25-19-17-24(18-20-25)29(33)35-23-21-31(4,6-2)7-3/h12-13,15-20H,5-11,14,21-23H2,1-4H3/p+1 |
| InChIKey | NQHNLNLJPDMBFN-UHFFFAOYSA-O |
| XLogP | 6.80 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | 599 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Otilonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Otilonium?
The IUPAC name of Otilonium (CID 72093) is diethyl-methyl-[2-[4-[(2-octoxybenzoyl)amino]benzoyl]oxyethyl]azanium.
What is the SMILES notation for Otilonium?
The canonical SMILES for Otilonium is CCCCCCCCOC1=CC=CC=C1C(=O)NC2=CC=C(C=C2)C(=O)OCC[N+](C)(CC)CC.
What is the InChIKey of Otilonium?
The InChIKey is NQHNLNLJPDMBFN-UHFFFAOYSA-O. The full InChI is InChI=1S/C29H42N2O4/c1-5-8-9-10-11-14-22-34-27-16-13-12-15-26(27)28(32)30-25-19-17-24(18-20-25)29(33)35-23-21-31(4,6-2)7-3/h12-13,15-20H,5-11,14,21-23H2,1-4H3/p+1.
What are the key properties of Otilonium?
Otilonium has a molecular weight of 483.70 g/mol, XLogP of 6.80, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Otilonium is sourced from PubChem (CID 72093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).