C26H27NO4 — CID 7209466
[(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(4-hydroxyphenyl)benzoate (PubChem CID 7209466) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(4-hydroxyphenyl)benzoate.
| Compound Name | [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(4-hydroxyphenyl)benzoate |
|---|---|
| PubChem CID | 7209466 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(2S)-1-[2-[(2S)-butan-2-yl]anilino]-1-oxopropan-2-yl] 4-(4-hydroxyphenyl)benzoate |
| SMILES | CC[C@H](C)c1ccccc1NC(=O)[C@H](C)OC(=O)c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-4-17(2)23-7-5-6-8-24(23)27-25(29)18(3)31-26(30)21-11-9-19(10-12-21)20-13-15-22(28)16-14-20/h5-18,28H,4H2,1-3H3,(H,27,29)/t17-,18-/m0/s1 |
| InChIKey | YUUAEPYMBGGFBC-ROUUACIJSA-N |
| XLogP | 5.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |