C18H19NO2S — CID 720979
(2S)-2-(4-methoxyphenyl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one (PubChem CID 720979) has the molecular formula C18H19NO2S and a molecular weight of 313.42 g/mol. Its IUPAC name is (2S)-2-(4-methoxyphenyl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one.
| Compound Name | (2S)-2-(4-methoxyphenyl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 720979 |
| Molecular Formula | C18H19NO2S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (2S)-2-(4-methoxyphenyl)-3-(2-phenylethyl)-1,3-thiazolidin-4-one |
| SMILES | COc1ccc([C@@H]2SCC(=O)N2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H19NO2S/c1-21-16-9-7-15(8-10-16)18-19(17(20)13-22-18)12-11-14-5-3-2-4-6-14/h2-10,18H,11-13H2,1H3/t18-/m0/s1 |
| InChIKey | XSZFNGBSMIARBY-SFHVURJKSA-N |
| XLogP | 3.51 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |