About (1,1-Dioxothian-3-yl) cyclopentanecarboxylate
(1,1-Dioxothian-3-yl) cyclopentanecarboxylate (PubChem CID 72102997) has the molecular formula C11H18O4S
and a molecular weight of 246.33 g/mol. Its IUPAC name is (1,1-dioxothian-3-yl) cyclopentanecarboxylate.
Molecular Properties
| Compound Name | (1,1-Dioxothian-3-yl) cyclopentanecarboxylate |
| PubChem CID | 72102997 |
| Molecular Formula | C11H18O4S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (1,1-dioxothian-3-yl) cyclopentanecarboxylate |
| SMILES | C1CCC(C1)C(=O)OC2CCCS(=O)(=O)C2 |
| InChI | InChI=1S/C11H18O4S/c12-11(9-4-1-2-5-9)15-10-6-3-7-16(13,14)8-10/h9-10H,1-8H2 |
| InChIKey | PNSVNDMAGCJOIA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 349 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,1-Dioxothian-3-yl) cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,1-Dioxothian-3-yl) cyclopentanecarboxylate?
The IUPAC name of (1,1-Dioxothian-3-yl) cyclopentanecarboxylate (CID 72102997) is (1,1-dioxothian-3-yl) cyclopentanecarboxylate.
What is the SMILES notation for (1,1-Dioxothian-3-yl) cyclopentanecarboxylate?
The canonical SMILES for (1,1-Dioxothian-3-yl) cyclopentanecarboxylate is C1CCC(C1)C(=O)OC2CCCS(=O)(=O)C2.
What is the InChIKey of (1,1-Dioxothian-3-yl) cyclopentanecarboxylate?
The InChIKey is PNSVNDMAGCJOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4S/c12-11(9-4-1-2-5-9)15-10-6-3-7-16(13,14)8-10/h9-10H,1-8H2.
What are the key properties of (1,1-Dioxothian-3-yl) cyclopentanecarboxylate?
(1,1-Dioxothian-3-yl) cyclopentanecarboxylate has a molecular weight of 246.33 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-Dioxothian-3-yl) cyclopentanecarboxylate is sourced from PubChem (CID 72102997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).