About 2-amino-4-propylphenol
2-amino-4-propylphenol (PubChem CID 721138) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2-amino-4-propylphenol.
Molecular Properties
| Compound Name | 2-amino-4-propylphenol |
| PubChem CID | 721138 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 2-amino-4-propylphenol |
| SMILES | CCCc1ccc(O)c(N)c1 |
| InChI | InChI=1S/C9H13NO/c1-2-3-7-4-5-9(11)8(10)6-7/h4-6,11H,2-3,10H2,1H3 |
| InChIKey | VXTJVMWIVSZHNI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-propylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-propylphenol?
The IUPAC name of 2-amino-4-propylphenol (CID 721138) is 2-amino-4-propylphenol.
What is the SMILES notation for 2-amino-4-propylphenol?
The canonical SMILES for 2-amino-4-propylphenol is CCCc1ccc(O)c(N)c1.
What is the InChIKey of 2-amino-4-propylphenol?
The InChIKey is VXTJVMWIVSZHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-3-7-4-5-9(11)8(10)6-7/h4-6,11H,2-3,10H2,1H3.
What are the key properties of 2-amino-4-propylphenol?
2-amino-4-propylphenol has a molecular weight of 151.21 g/mol, XLogP of 1.93, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-propylphenol is sourced from PubChem (CID 721138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).